C28H41NO3S — CID 155748609
O-[3-hydroxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-[2-methyl-2-(oxiran-2-yl)propyl]carbamothioate (PubChem CID 155748609) has the molecular formula C28H41NO3S and a molecular weight of 471.71 g/mol. Its IUPAC name is O-[3-hydroxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-[2-methyl-2-(oxiran-2-yl)propyl]carbamothioate.
| Compound Name | O-[3-hydroxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-[2-methyl-2-(oxiran-2-yl)propyl]carbamothioate |
|---|---|
| PubChem CID | 155748609 |
| Molecular Formula | C28H41NO3S |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | O-[3-hydroxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-[2-methyl-2-(oxiran-2-yl)propyl]carbamothioate |
| SMILES | C=C(C)[C@@H]1CCC(C)=CC1c1c(O)cc(CCCCC)cc1OC(=S)NCC(C)(C)C1CO1 |
| InChI | InChI=1S/C28H41NO3S/c1-7-8-9-10-20-14-23(30)26(22-13-19(4)11-12-21(22)18(2)3)24(15-20)32-27(33)29-17-28(5,6)25-16-31-25/h13-15,21-22,25,30H,2,7-12,16-17H2,1,3-6H3,(H,29,33)/t21-,22?,25?/m0/s1 |
| InChIKey | XFQKRLVOFGFNQV-LBXYRFPKSA-N |
| XLogP | 6.82 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|