C33H55BN4O2S — CID 167631269
CID 167631269 (PubChem CID 167631269) has the molecular formula C33H55BN4O2S and a molecular weight of 583.71 g/mol.
| Compound Name | CID 167631269 |
|---|---|
| PubChem CID | 167631269 |
| Molecular Formula | C33H55BN4O2S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.42 |
| IUPAC Name | — |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=S)NCC1CN1CC.CCN1CC1CN.[2H]C[B] |
| InChI | InChI=1S/C27H40N2O2S.C5H12N2.CH3B/c1-6-8-9-10-20-14-24(30)26(23-13-19(5)11-12-22(23)18(3)4)25(15-20)31-27(32)28-16-21-17-29(21)7-2;1-2-7-4-5(7)3-6;1-2/h13-15,21-23,30H,3,6-12,16-17H2,1-2,4-5H3,(H,28,32);5H,2-4,6H2,1H3;1H3/t21?,22-,23+,29?;;/m0../s1/i;;1D |
| InChIKey | FBXXPQBAZXBOBS-XJVAANKRSA-N |
| XLogP | 5.95 |
| TPSA | 73.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|