C27H38O3S2 — CID 164935622
O-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(oxiran-2-yl)propan-2-ylsulfanylmethanethioate (PubChem CID 164935622) has the molecular formula C27H38O3S2 and a molecular weight of 474.73 g/mol. Its IUPAC name is O-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(oxiran-2-yl)propan-2-ylsulfanylmethanethioate.
| Compound Name | O-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(oxiran-2-yl)propan-2-ylsulfanylmethanethioate |
|---|---|
| PubChem CID | 164935622 |
| Molecular Formula | C27H38O3S2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | O-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(oxiran-2-yl)propan-2-ylsulfanylmethanethioate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=S)SC(C)(C)C1CO1 |
| InChI | InChI=1S/C27H38O3S2/c1-7-8-9-10-19-14-22(28)25(21-13-18(4)11-12-20(21)17(2)3)23(15-19)30-26(31)32-27(5,6)24-16-29-24/h13-15,20-21,24,28H,2,7-12,16H2,1,3-6H3/t20-,21+,24?/m0/s1 |
| InChIKey | QMEVAKWUPFXPBZ-LDJQHZOJSA-N |
| XLogP | 7.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|