C28H41NO4 — CID 155447780
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-[3-(oxetan-3-yl)propyl]carbamate (PubChem CID 155447780) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-[3-(oxetan-3-yl)propyl]carbamate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-[3-(oxetan-3-yl)propyl]carbamate |
|---|---|
| PubChem CID | 155447780 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-[3-(oxetan-3-yl)propyl]carbamate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)NCCCC1COC1 |
| InChI | InChI=1S/C28H41NO4/c1-5-6-7-9-21-15-25(30)27(24-14-20(4)11-12-23(24)19(2)3)26(16-21)33-28(31)29-13-8-10-22-17-32-18-22/h14-16,22-24,30H,2,5-13,17-18H2,1,3-4H3,(H,29,31)/t23-,24+/m0/s1 |
| InChIKey | BGIQGLYLLPPWHZ-BJKOFHAPSA-N |
| XLogP | 6.66 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|