C32H33NO2 — CID 155448375
2-[(2E)-2-(5-tert-butyl-3,3-dimethyl-1-propan-2-ylindol-2-ylidene)ethylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 155448375) has the molecular formula C32H33NO2 and a molecular weight of 463.62 g/mol. Its IUPAC name is 2-[(2E)-2-(5-tert-butyl-3,3-dimethyl-1-propan-2-ylindol-2-ylidene)ethylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(2E)-2-(5-tert-butyl-3,3-dimethyl-1-propan-2-ylindol-2-ylidene)ethylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 155448375 |
| Molecular Formula | C32H33NO2 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 2-[(2E)-2-(5-tert-butyl-3,3-dimethyl-1-propan-2-ylindol-2-ylidene)ethylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CC(C)N1/C(=C/C=C2C(=O)c3cc4ccccc4cc3C2=O)C(C)(C)c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C32H33NO2/c1-19(2)33-27-14-12-22(31(3,4)5)18-26(27)32(6,7)28(33)15-13-23-29(34)24-16-20-10-8-9-11-21(20)17-25(24)30(23)35/h8-19H,1-7H3/b28-15+ |
| InChIKey | XPPJBSPXZWDRTK-RWPZCVJISA-N |
| XLogP | 7.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|