C14H19NO — CID 155464717
6-methyl-2,3,4,4a,9,9a-hexahydro-1H-xanthen-9-amine (PubChem CID 155464717) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 6-methyl-2,3,4,4a,9,9a-hexahydro-1H-xanthen-9-amine.
| Compound Name | 6-methyl-2,3,4,4a,9,9a-hexahydro-1H-xanthen-9-amine |
|---|---|
| PubChem CID | 155464717 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 6-methyl-2,3,4,4a,9,9a-hexahydro-1H-xanthen-9-amine |
| SMILES | Cc1ccc2c(c1)OC1CCCCC1C2N |
| InChI | InChI=1S/C14H19NO/c1-9-6-7-11-13(8-9)16-12-5-3-2-4-10(12)14(11)15/h6-8,10,12,14H,2-5,15H2,1H3 |
| InChIKey | QKTXXKXJYDSCCN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |