C32H32N2O4 — CID 155485330
5-(1,3-dioxo-2-pentan-3-ylisoindol-5-yl)-2-(4-pentan-3-ylphenyl)isoindole-1,3-dione (PubChem CID 155485330) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 5-(1,3-dioxo-2-pentan-3-ylisoindol-5-yl)-2-(4-pentan-3-ylphenyl)isoindole-1,3-dione.
| Compound Name | 5-(1,3-dioxo-2-pentan-3-ylisoindol-5-yl)-2-(4-pentan-3-ylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155485330 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 5-(1,3-dioxo-2-pentan-3-ylisoindol-5-yl)-2-(4-pentan-3-ylphenyl)isoindole-1,3-dione |
| SMILES | CCC(CC)c1ccc(N2C(=O)c3ccc(-c4ccc5c(c4)C(=O)N(C(CC)CC)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C32H32N2O4/c1-5-19(6-2)20-9-13-24(14-10-20)34-30(36)26-16-12-22(18-28(26)32(34)38)21-11-15-25-27(17-21)31(37)33(29(25)35)23(7-3)8-4/h9-19,23H,5-8H2,1-4H3 |
| InChIKey | YIUHTLRLTNIOJS-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|