C48H42N2O8S — CID 146355771
6-pentan-3-yl-13-[4-[4-[4-(4-pentan-3-ylphenoxy)phenyl]sulfonylphenoxy]phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 146355771) has the molecular formula C48H42N2O8S and a molecular weight of 806.94 g/mol. Its IUPAC name is 6-pentan-3-yl-13-[4-[4-[4-(4-pentan-3-ylphenoxy)phenyl]sulfonylphenoxy]phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-pentan-3-yl-13-[4-[4-[4-(4-pentan-3-ylphenoxy)phenyl]sulfonylphenoxy]phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 146355771 |
| Molecular Formula | C48H42N2O8S |
| Molecular Weight | 806.94 g/mol |
| Exact Mass | 806.27 |
| IUPAC Name | 6-pentan-3-yl-13-[4-[4-[4-(4-pentan-3-ylphenoxy)phenyl]sulfonylphenoxy]phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCC(CC)c1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N5C(=O)c6ccc7c8c(ccc(c68)C5=O)C(=O)N(C(CC)CC)C7=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H42N2O8S/c1-5-29(6-2)30-9-13-33(14-10-30)57-35-17-21-37(22-18-35)59(55,56)38-23-19-36(20-24-38)58-34-15-11-32(12-16-34)50-47(53)41-27-25-39-43-40(26-28-42(44(41)43)48(50)54)46(52)49(45(39)51)31(7-3)8-4/h9-29,31H,5-8H2,1-4H3 |
| InChIKey | SDYOBBBZJQRMRV-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.94 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|