C17H14F8N2O6S2 — CID 155519566
2-hydroxy-2-methyl-N-[4-nitro-2-(trifluoromethyl)phenyl]-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfonylpropanamide (PubChem CID 155519566) has the molecular formula C17H14F8N2O6S2 and a molecular weight of 558.43 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-[4-nitro-2-(trifluoromethyl)phenyl]-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfonylpropanamide.
| Compound Name | 2-hydroxy-2-methyl-N-[4-nitro-2-(trifluoromethyl)phenyl]-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 155519566 |
| Molecular Formula | C17H14F8N2O6S2 |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 558.02 |
| IUPAC Name | 2-hydroxy-2-methyl-N-[4-nitro-2-(trifluoromethyl)phenyl]-3-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfonylpropanamide |
| SMILES | CC(O)(CS(=O)(=O)c1ccc(S(F)(F)(F)(F)F)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C17H14F8N2O6S2/c1-16(29,9-34(32,33)11-3-5-12(6-4-11)35(21,22,23,24)25)15(28)26-14-7-2-10(27(30)31)8-13(14)17(18,19)20/h2-8,29H,9H2,1H3,(H,26,28) |
| InChIKey | GQZXSKLMDMYPLA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|