C27H35F3N4O4S2 — CID 155521165
(2S)-1-[2-[4-[2-(2-aminoethyldisulfanyl)ethoxy]-3-methoxyphenyl]ethylamino]-3-[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenoxy]propan-2-ol (PubChem CID 155521165) has the molecular formula C27H35F3N4O4S2 and a molecular weight of 600.73 g/mol. Its IUPAC name is (2S)-1-[2-[4-[2-(2-aminoethyldisulfanyl)ethoxy]-3-methoxyphenyl]ethylamino]-3-[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-[2-[4-[2-(2-aminoethyldisulfanyl)ethoxy]-3-methoxyphenyl]ethylamino]-3-[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 155521165 |
| Molecular Formula | C27H35F3N4O4S2 |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | (2S)-1-[2-[4-[2-(2-aminoethyldisulfanyl)ethoxy]-3-methoxyphenyl]ethylamino]-3-[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenoxy]propan-2-ol |
| SMILES | COc1cc(CCNC[C@H](O)COc2ccc(-c3nc(C(F)(F)F)cn3C)cc2)ccc1OCCSSCCN |
| InChI | InChI=1S/C27H35F3N4O4S2/c1-34-17-25(27(28,29)30)33-26(34)20-4-6-22(7-5-20)38-18-21(35)16-32-11-9-19-3-8-23(24(15-19)36-2)37-12-14-40-39-13-10-31/h3-8,15,17,21,32,35H,9-14,16,18,31H2,1-2H3/t21-/m0/s1 |
| InChIKey | CGBTUHCDUMYYPF-NRFANRHFSA-N |
| XLogP | 4.41 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|