C23H27N7O7S — CID 155523483
(2S,5S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-7-(3-sulfamoylphenyl)hept-6-ynoic acid (PubChem CID 155523483) has the molecular formula C23H27N7O7S and a molecular weight of 545.58 g/mol. Its IUPAC name is (2S,5S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-7-(3-sulfamoylphenyl)hept-6-ynoic acid.
| Compound Name | (2S,5S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-7-(3-sulfamoylphenyl)hept-6-ynoic acid |
|---|---|
| PubChem CID | 155523483 |
| Molecular Formula | C23H27N7O7S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | (2S,5S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-7-(3-sulfamoylphenyl)hept-6-ynoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C[C@@H](C#Cc2cccc(S(N)(=O)=O)c2)CC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H27N7O7S/c24-15(23(33)34)7-6-13(5-4-12-2-1-3-14(8-12)38(26,35)36)9-16-18(31)19(32)22(37-16)30-11-29-17-20(25)27-10-28-21(17)30/h1-3,8,10-11,13,15-16,18-19,22,31-32H,6-7,9,24H2,(H,33,34)(H2,25,27,28)(H2,26,35,36)/t13-,15-,16+,18+,19+,22+/m0/s1 |
| InChIKey | YPTRZUZOSZNLSX-AVYFSKKJSA-N |
| XLogP | -1.07 |
| TPSA | 242.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|