C21H13NO5S — CID 155531009
5-[(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)methyl]-1,3,4-oxathiazol-2-one (PubChem CID 155531009) has the molecular formula C21H13NO5S and a molecular weight of 391.40 g/mol. Its IUPAC name is 5-[(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)methyl]-1,3,4-oxathiazol-2-one.
| Compound Name | 5-[(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)methyl]-1,3,4-oxathiazol-2-one |
|---|---|
| PubChem CID | 155531009 |
| Molecular Formula | C21H13NO5S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 5-[(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)methyl]-1,3,4-oxathiazol-2-one |
| SMILES | Cc1c(Cc2nsc(=O)o2)c(=O)oc2cc3occ(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C21H13NO5S/c1-11-13-7-15-16(12-5-3-2-4-6-12)10-25-17(15)9-18(13)26-20(23)14(11)8-19-22-28-21(24)27-19/h2-7,9-10H,8H2,1H3 |
| InChIKey | HCCIFUFGGXYTCH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|