C29H32N2O6 — CID 155563083
N-(5,6-dimethoxy-2-pyridinyl)-5-methoxy-2,2-dimethyl-N-(2-phenylmethoxyethyl)chromene-6-carboxamide (PubChem CID 155563083) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is N-(5,6-dimethoxy-2-pyridinyl)-5-methoxy-2,2-dimethyl-N-(2-phenylmethoxyethyl)chromene-6-carboxamide.
| Compound Name | N-(5,6-dimethoxy-2-pyridinyl)-5-methoxy-2,2-dimethyl-N-(2-phenylmethoxyethyl)chromene-6-carboxamide |
|---|---|
| PubChem CID | 155563083 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | N-(5,6-dimethoxy-2-pyridinyl)-5-methoxy-2,2-dimethyl-N-(2-phenylmethoxyethyl)chromene-6-carboxamide |
| SMILES | COc1ccc(N(CCOCc2ccccc2)C(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)nc1OC |
| InChI | InChI=1S/C29H32N2O6/c1-29(2)16-15-21-23(37-29)12-11-22(26(21)34-4)28(32)31(17-18-36-19-20-9-7-6-8-10-20)25-14-13-24(33-3)27(30-25)35-5/h6-16H,17-19H2,1-5H3 |
| InChIKey | DNIYQPISRKYFQH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|