About CID 155578738
CID 155578738 (PubChem CID 155578738) has the molecular formula C22H29BS2
and a molecular weight of 368.42 g/mol.
Molecular Properties
| Compound Name | CID 155578738 |
| PubChem CID | 155578738 |
| Molecular Formula | C22H29BS2 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | — |
| SMILES | [B]C(CCC)CC(CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C22H29BS2/c1-2-9-21(23)16-22(25-18-20-12-7-4-8-13-20)14-15-24-17-19-10-5-3-6-11-19/h3-8,10-13,21-22H,2,9,14-18H2,1H3 |
| InChIKey | AUQIOQHEGFJCNN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155578738 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155578738?
The IUPAC name of CID 155578738 (CID 155578738) is not available.
What is the SMILES notation for CID 155578738?
The canonical SMILES for CID 155578738 is [B]C(CCC)CC(CCSCc1ccccc1)SCc1ccccc1.
What is the InChIKey of CID 155578738?
The InChIKey is AUQIOQHEGFJCNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29BS2/c1-2-9-21(23)16-22(25-18-20-12-7-4-8-13-20)14-15-24-17-19-10-5-3-6-11-19/h3-8,10-13,21-22H,2,9,14-18H2,1H3.
What are the key properties of CID 155578738?
CID 155578738 has a molecular weight of 368.42 g/mol, XLogP of 6.76, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155578738 is sourced from PubChem (CID 155578738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).