C22H28B2S2 — CID 155578753
CID 155578753 (PubChem CID 155578753) has the molecular formula C22H28B2S2 and a molecular weight of 378.22 g/mol.
| Compound Name | CID 155578753 |
|---|---|
| PubChem CID | 155578753 |
| Molecular Formula | C22H28B2S2 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | — |
| SMILES | [B]c1ccc([B])c(CSCCC(CCCCC)SCc2ccccc2)c1 |
| InChI | InChI=1S/C22H28B2S2/c1-2-3-5-10-21(26-16-18-8-6-4-7-9-18)13-14-25-17-19-15-20(23)11-12-22(19)24/h4,6-9,11-12,15,21H,2-3,5,10,13-14,16-17H2,1H3 |
| InChIKey | PASUKWXYAXZBAE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|