C22H51NO6Si3 — CID 155602995
[4-[3-[[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propoxy]-2,2,6,6-tetramethylpiperidin-1-yl]methanol (PubChem CID 155602995) has the molecular formula C22H51NO6Si3 and a molecular weight of 509.91 g/mol. Its IUPAC name is [4-[3-[[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propoxy]-2,2,6,6-tetramethylpiperidin-1-yl]methanol.
| Compound Name | [4-[3-[[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propoxy]-2,2,6,6-tetramethylpiperidin-1-yl]methanol |
|---|---|
| PubChem CID | 155602995 |
| Molecular Formula | C22H51NO6Si3 |
| Molecular Weight | 509.91 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | [4-[3-[[dimethyl(2-trimethoxysilylethyl)silyl]oxy-dimethylsilyl]propoxy]-2,2,6,6-tetramethylpiperidin-1-yl]methanol |
| SMILES | CO[Si](CC[Si](C)(C)O[Si](C)(C)CCCOC1CC(C)(C)N(CO)C(C)(C)C1)(OC)OC |
| InChI | InChI=1S/C22H51NO6Si3/c1-21(2)17-20(18-22(3,4)23(21)19-24)28-13-12-14-30(8,9)29-31(10,11)15-16-32(25-5,26-6)27-7/h20,24H,12-19H2,1-11H3 |
| InChIKey | QZOATPFNMOMWDR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|