C29H32BrN3O2SSi — CID 155629320
6-bromo-8-[3-[tert-butyl(diphenyl)silyl]oxycyclobutyl]-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 155629320) has the molecular formula C29H32BrN3O2SSi and a molecular weight of 594.65 g/mol. Its IUPAC name is 6-bromo-8-[3-[tert-butyl(diphenyl)silyl]oxycyclobutyl]-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-bromo-8-[3-[tert-butyl(diphenyl)silyl]oxycyclobutyl]-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 155629320 |
| Molecular Formula | C29H32BrN3O2SSi |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 593.12 |
| IUPAC Name | 6-bromo-8-[3-[tert-butyl(diphenyl)silyl]oxycyclobutyl]-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CSc1ncc2c(C)c(Br)c(=O)n(C3CC(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C3)c2n1 |
| InChI | InChI=1S/C29H32BrN3O2SSi/c1-19-24-18-31-28(36-5)32-26(24)33(27(34)25(19)30)20-16-21(17-20)35-37(29(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,18,20-21H,16-17H2,1-5H3 |
| InChIKey | ZAPZRMGRQNGPOV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|