C26H38O9 — CID 155639531
1-O-[2-(2-hydroxyethoxy)ethyl] 5-O-[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyethyl] 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 155639531) has the molecular formula C26H38O9 and a molecular weight of 494.58 g/mol. Its IUPAC name is 1-O-[2-(2-hydroxyethoxy)ethyl] 5-O-[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyethyl] 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-(2-hydroxyethoxy)ethyl] 5-O-[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyethyl] 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 155639531 |
| Molecular Formula | C26H38O9 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 1-O-[2-(2-hydroxyethoxy)ethyl] 5-O-[2-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]oxyethyl] 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCOC(=O)/C=C/c1ccc(OC)cc1)C(=O)OCCOCCO |
| InChI | InChI=1S/C26H38O9/c1-6-26(4,24(30)35-16-15-32-14-13-27)19-25(2,3)23(29)34-18-17-33-22(28)12-9-20-7-10-21(31-5)11-8-20/h7-12,27H,6,13-19H2,1-5H3/b12-9+ |
| InChIKey | JVYVMCIFPAHSCZ-FMIVXFBMSA-N |
| XLogP | 3.18 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|