C20H36N4O5Si — CID 155641048
tert-butyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethylcarbamoyl]-3-oxo-2,5,6,8-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate (PubChem CID 155641048) has the molecular formula C20H36N4O5Si and a molecular weight of 440.62 g/mol. Its IUPAC name is tert-butyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethylcarbamoyl]-3-oxo-2,5,6,8-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethylcarbamoyl]-3-oxo-2,5,6,8-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 155641048 |
| Molecular Formula | C20H36N4O5Si |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | tert-butyl 1-[2-[tert-butyl(dimethyl)silyl]oxyethylcarbamoyl]-3-oxo-2,5,6,8-tetrahydroimidazo[1,5-a]pyrazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCn2c(c(C(=O)NCCO[Si](C)(C)C(C)(C)C)[nH]c2=O)C1 |
| InChI | InChI=1S/C20H36N4O5Si/c1-19(2,3)29-18(27)23-10-11-24-14(13-23)15(22-17(24)26)16(25)21-9-12-28-30(7,8)20(4,5)6/h9-13H2,1-8H3,(H,21,25)(H,22,26) |
| InChIKey | OHNCFSISSLRALL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|