C42H40N4O8S2 — CID 155661532
[3-[[3-[[(3-naphthalen-2-ylsulfonyloxyphenyl)carbamoylamino]methyl]cyclohexyl]methylcarbamoylamino]phenyl] naphthalene-2-sulfonate (PubChem CID 155661532) has the molecular formula C42H40N4O8S2 and a molecular weight of 792.94 g/mol. Its IUPAC name is [3-[[3-[[(3-naphthalen-2-ylsulfonyloxyphenyl)carbamoylamino]methyl]cyclohexyl]methylcarbamoylamino]phenyl] naphthalene-2-sulfonate.
| Compound Name | [3-[[3-[[(3-naphthalen-2-ylsulfonyloxyphenyl)carbamoylamino]methyl]cyclohexyl]methylcarbamoylamino]phenyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 155661532 |
| Molecular Formula | C42H40N4O8S2 |
| Molecular Weight | 792.94 g/mol |
| Exact Mass | 792.23 |
| IUPAC Name | [3-[[3-[[(3-naphthalen-2-ylsulfonyloxyphenyl)carbamoylamino]methyl]cyclohexyl]methylcarbamoylamino]phenyl] naphthalene-2-sulfonate |
| SMILES | O=C(NCC1CCCC(CNC(=O)Nc2cccc(OS(=O)(=O)c3ccc4ccccc4c3)c2)C1)Nc1cccc(OS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C42H40N4O8S2/c47-41(45-35-14-6-16-37(25-35)53-55(49,50)39-20-18-31-10-1-3-12-33(31)23-39)43-27-29-8-5-9-30(22-29)28-44-42(48)46-36-15-7-17-38(26-36)54-56(51,52)40-21-19-32-11-2-4-13-34(32)24-40/h1-4,6-7,10-21,23-26,29-30H,5,8-9,22,27-28H2,(H2,43,45,47)(H2,44,46,48) |
| InChIKey | SCJNLVQIOLIXGK-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.94 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|