C15H12ClF3N6O — CID 155671486
N-(2-chloro-9-propan-2-ylpurin-6-yl)-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 155671486) has the molecular formula C15H12ClF3N6O and a molecular weight of 384.75 g/mol. Its IUPAC name is N-(2-chloro-9-propan-2-ylpurin-6-yl)-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-(2-chloro-9-propan-2-ylpurin-6-yl)-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155671486 |
| Molecular Formula | C15H12ClF3N6O |
| Molecular Weight | 384.75 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-(2-chloro-9-propan-2-ylpurin-6-yl)-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | CC(C)n1cnc2c(NC(=O)c3ccnc(C(F)(F)F)c3)nc(Cl)nc21 |
| InChI | InChI=1S/C15H12ClF3N6O/c1-7(2)25-6-21-10-11(23-14(16)24-12(10)25)22-13(26)8-3-4-20-9(5-8)15(17,18)19/h3-7H,1-2H3,(H,22,23,24,26) |
| InChIKey | NTCXYOVQECWJRL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |