C19H26FN2O3SY- — CID 155692920
5-[1-(2-ethoxycarbonyl-4-fluoro-6-methylanilino)-1-oxobutan-2-yl]iminopentane-1-thiolate;yttrium (PubChem CID 155692920) has the molecular formula C19H26FN2O3SY- and a molecular weight of 470.40 g/mol. Its IUPAC name is 5-[1-(2-ethoxycarbonyl-4-fluoro-6-methylanilino)-1-oxobutan-2-yl]iminopentane-1-thiolate;yttrium.
| Compound Name | 5-[1-(2-ethoxycarbonyl-4-fluoro-6-methylanilino)-1-oxobutan-2-yl]iminopentane-1-thiolate;yttrium |
|---|---|
| PubChem CID | 155692920 |
| Molecular Formula | C19H26FN2O3SY- |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 5-[1-(2-ethoxycarbonyl-4-fluoro-6-methylanilino)-1-oxobutan-2-yl]iminopentane-1-thiolate;yttrium |
| SMILES | CCOC(=O)c1cc(F)cc(C)c1NC(=O)C(CC)/N=C/CCCC[S-].[Y] |
| InChI | InChI=1S/C19H27FN2O3S.Y/c1-4-16(21-9-7-6-8-10-26)18(23)22-17-13(3)11-14(20)12-15(17)19(24)25-5-2;/h9,11-12,16,26H,4-8,10H2,1-3H3,(H,22,23);/p-1/b21-9+; |
| InChIKey | OCNASDJUMDPIMR-CSFJJMQLSA-M |
| XLogP | 3.81 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|