C24H44N4O10 — CID 155705789
3,3-dimethyl-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanedioic acid;propane (PubChem CID 155705789) has the molecular formula C24H44N4O10 and a molecular weight of 548.63 g/mol. Its IUPAC name is 3,3-dimethyl-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanedioic acid;propane.
| Compound Name | 3,3-dimethyl-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanedioic acid;propane |
|---|---|
| PubChem CID | 155705789 |
| Molecular Formula | C24H44N4O10 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 3,3-dimethyl-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanedioic acid;propane |
| SMILES | CC(C)(CC(=O)O)C(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1.CCC |
| InChI | InChI=1S/C21H36N4O10.C3H8/c1-21(2,11-15(26)27)19(20(34)35)25-9-7-23(13-17(30)31)5-3-22(12-16(28)29)4-6-24(8-10-25)14-18(32)33;1-3-2/h19H,3-14H2,1-2H3,(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H,34,35);3H2,1-2H3 |
| InChIKey | SNGISFLXJGCZTR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 199.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |