C23H38 — CID 155717440
ethane;1-ethenyl-2-methylbenzene;(3E,5E)-2,2,3,6-tetramethylocta-3,5-diene (PubChem CID 155717440) has the molecular formula C23H38 and a molecular weight of 314.56 g/mol. Its IUPAC name is ethane;1-ethenyl-2-methylbenzene;(3E,5E)-2,2,3,6-tetramethylocta-3,5-diene.
| Compound Name | ethane;1-ethenyl-2-methylbenzene;(3E,5E)-2,2,3,6-tetramethylocta-3,5-diene |
|---|---|
| PubChem CID | 155717440 |
| Molecular Formula | C23H38 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | ethane;1-ethenyl-2-methylbenzene;(3E,5E)-2,2,3,6-tetramethylocta-3,5-diene |
| SMILES | C=Cc1ccccc1C.CC.CC/C(C)=C/C=C(\C)C(C)(C)C |
| InChI | InChI=1S/C12H22.C9H10.C2H6/c1-7-10(2)8-9-11(3)12(4,5)6;1-3-9-7-5-4-6-8(9)2;1-2/h8-9H,7H2,1-6H3;3-7H,1H2,2H3;1-2H3/b10-8+,11-9+;; |
| InChIKey | JZNYCXOBUMUJKI-SZNDJZPWSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|