C23H42O3 — CID 155735548
(2R,3R,6S)-2-[[(2R,5E)-7-(2-ethylbutoxy)octa-5,7-dien-2-yl]oxymethyl]-3,5,6-trimethyloxane (PubChem CID 155735548) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is (2R,3R,6S)-2-[[(2R,5E)-7-(2-ethylbutoxy)octa-5,7-dien-2-yl]oxymethyl]-3,5,6-trimethyloxane.
| Compound Name | (2R,3R,6S)-2-[[(2R,5E)-7-(2-ethylbutoxy)octa-5,7-dien-2-yl]oxymethyl]-3,5,6-trimethyloxane |
|---|---|
| PubChem CID | 155735548 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | (2R,3R,6S)-2-[[(2R,5E)-7-(2-ethylbutoxy)octa-5,7-dien-2-yl]oxymethyl]-3,5,6-trimethyloxane |
| SMILES | C=C(/C=C/CC[C@@H](C)OC[C@@H]1O[C@@H](C)C(C)C[C@H]1C)OCC(CC)CC |
| InChI | InChI=1S/C23H42O3/c1-8-22(9-2)15-24-19(5)12-10-11-13-20(6)25-16-23-18(4)14-17(3)21(7)26-23/h10,12,17-18,20-23H,5,8-9,11,13-16H2,1-4,6-7H3/b12-10+/t17?,18-,20-,21+,23+/m1/s1 |
| InChIKey | SGSTWZHGHLVBQA-HNZXBSOJSA-N |
| XLogP | 6.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|