C17H40O2Si2 — CID 155771709
[dimethyl(5-methylnonan-5-yloxy)silyl]oxy-dimethyl-propylsilane (PubChem CID 155771709) has the molecular formula C17H40O2Si2 and a molecular weight of 332.68 g/mol. Its IUPAC name is [dimethyl(5-methylnonan-5-yloxy)silyl]oxy-dimethyl-propylsilane.
| Compound Name | [dimethyl(5-methylnonan-5-yloxy)silyl]oxy-dimethyl-propylsilane |
|---|---|
| PubChem CID | 155771709 |
| Molecular Formula | C17H40O2Si2 |
| Molecular Weight | 332.68 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | [dimethyl(5-methylnonan-5-yloxy)silyl]oxy-dimethyl-propylsilane |
| SMILES | CCCCC(C)(CCCC)O[Si](C)(C)O[Si](C)(C)CCC |
| InChI | InChI=1S/C17H40O2Si2/c1-9-12-14-17(4,15-13-10-2)18-21(7,8)19-20(5,6)16-11-3/h9-16H2,1-8H3 |
| InChIKey | RXZRCQFLZLSIGD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|