C3H3I2O2- — CID 155784790
2,3-diiodopropanoate (PubChem CID 155784790) has the molecular formula C3H3I2O2- and a molecular weight of 324.86 g/mol. Its IUPAC name is 2,3-diiodopropanoate.
| Compound Name | 2,3-diiodopropanoate |
|---|---|
| PubChem CID | 155784790 |
| Molecular Formula | C3H3I2O2- |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.82 |
| IUPAC Name | 2,3-diiodopropanoate |
| SMILES | O=C([O-])C(I)CI |
| InChI | InChI=1S/C3H4I2O2/c4-1-2(5)3(6)7/h2H,1H2,(H,6,7)/p-1 |
| InChIKey | NFEQHPRQOQMUSG-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|