About lithium 2-iodoacetate
lithium 2-iodoacetate (PubChem CID 23677321) has the molecular formula C2H2ILiO2
and a molecular weight of 191.88 g/mol. Its IUPAC name is lithium 2-iodoacetate.
Molecular Properties
| Compound Name | lithium 2-iodoacetate |
| PubChem CID | 23677321 |
| Molecular Formula | C2H2ILiO2 |
| Molecular Weight | 191.88 g/mol |
| Exact Mass | 191.93 |
| IUPAC Name | lithium 2-iodoacetate |
| SMILES | O=C([O-])CI.[Li+] |
| InChI | InChI=1S/C2H3IO2.Li/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | RZCFQIDTJPHHFJ-UHFFFAOYSA-M |
| XLogP | -3.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.88 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-iodoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-iodoacetate?
The IUPAC name of lithium 2-iodoacetate (CID 23677321) is lithium 2-iodoacetate.
What is the SMILES notation for lithium 2-iodoacetate?
The canonical SMILES for lithium 2-iodoacetate is O=C([O-])CI.[Li+].
What is the InChIKey of lithium 2-iodoacetate?
The InChIKey is RZCFQIDTJPHHFJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3IO2.Li/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1.
What are the key properties of lithium 2-iodoacetate?
lithium 2-iodoacetate has a molecular weight of 191.88 g/mol, XLogP of -3.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-iodoacetate is sourced from PubChem (CID 23677321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).