C6H6CdI4O4 — CID 22604603
cadmium(2+);bis(2,3-diiodopropanoate) (PubChem CID 22604603) has the molecular formula C6H6CdI4O4 and a molecular weight of 762.14 g/mol. Its IUPAC name is cadmium(2+);bis(2,3-diiodopropanoate).
| Compound Name | cadmium(2+);bis(2,3-diiodopropanoate) |
|---|---|
| PubChem CID | 22604603 |
| Molecular Formula | C6H6CdI4O4 |
| Molecular Weight | 762.14 g/mol |
| Exact Mass | 763.55 |
| IUPAC Name | cadmium(2+);bis(2,3-diiodopropanoate) |
| SMILES | O=C([O-])C(I)CI.O=C([O-])C(I)CI.[Cd+2] |
| InChI | InChI=1S/2C3H4I2O2.Cd/c2*4-1-2(5)3(6)7;/h2*2H,1H2,(H,6,7);/q;;+2/p-2 |
| InChIKey | XPHUGBBWEFPBNG-UHFFFAOYSA-L |
| XLogP | -0.05 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.14 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|