C10H5F9N4O6S — CID 155788483
3-methyl-4-nitro-1-(trifluoromethoxy)-6-(trifluoromethyl)benzotriazol-3-ium;trifluoromethanesulfonate (PubChem CID 155788483) has the molecular formula C10H5F9N4O6S and a molecular weight of 480.22 g/mol. Its IUPAC name is 3-methyl-4-nitro-1-(trifluoromethoxy)-6-(trifluoromethyl)benzotriazol-3-ium;trifluoromethanesulfonate.
| Compound Name | 3-methyl-4-nitro-1-(trifluoromethoxy)-6-(trifluoromethyl)benzotriazol-3-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155788483 |
| Molecular Formula | C10H5F9N4O6S |
| Molecular Weight | 480.22 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | 3-methyl-4-nitro-1-(trifluoromethoxy)-6-(trifluoromethyl)benzotriazol-3-ium;trifluoromethanesulfonate |
| SMILES | C[n+]1nn(OC(F)(F)F)c2cc(C(F)(F)F)cc([N+](=O)[O-])c21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H5F6N4O3.CHF3O3S/c1-17-7-5(18(16-17)22-9(13,14)15)2-4(8(10,11)12)3-6(7)19(20)21;2-1(3,4)8(5,6)7/h2-3H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | BXUUFDNWKHBJBN-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|