C11H15ClN2O2S — CID 155839888
N-[(3S,3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrol-3-yl]thiophene-3-carboxamide;hydrochloride (PubChem CID 155839888) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is N-[(3S,3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrol-3-yl]thiophene-3-carboxamide;hydrochloride.
| Compound Name | N-[(3S,3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrol-3-yl]thiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 155839888 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N-[(3S,3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-furo[3,4-b]pyrrol-3-yl]thiophene-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(N[C@@H]1CN[C@@H]2COC[C@@H]21)c1ccsc1 |
| InChI | InChI=1S/C11H14N2O2S.ClH/c14-11(7-1-2-16-6-7)13-9-3-12-10-5-15-4-8(9)10;/h1-2,6,8-10,12H,3-5H2,(H,13,14);1H/t8-,9-,10-;/m1./s1 |
| InChIKey | BQMJVYXXTJIKKI-RWDYHCJXSA-N |
| XLogP | 0.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |