C16H23F3N4O4S — CID 155843779
3-[[(3R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid (PubChem CID 155843779) has the molecular formula C16H23F3N4O4S and a molecular weight of 424.45 g/mol. Its IUPAC name is 3-[[(3R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(3R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843779 |
| Molecular Formula | C16H23F3N4O4S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 3-[[(3R,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)NC[C@@H]1CO[C@@H]2CN(Cc3nccs3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4O2S.C2HF3O2/c1-17(2)14(19)16-5-10-9-20-12-7-18(6-11(10)12)8-13-15-3-4-21-13;3-2(4,5)1(6)7/h3-4,10-12H,5-9H2,1-2H3,(H,16,19);(H,6,7)/t10-,11-,12-;/m1./s1 |
| InChIKey | NPCIJQIFBJPYFV-AUYLJXNTSA-N |
| XLogP | 1.49 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |