C10H17NO4S — CID 155886469
methyl 2-acetamido-3-(4-hydroxybut-2-enylsulfanyl)propanoate (PubChem CID 155886469) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is methyl 2-acetamido-3-(4-hydroxybut-2-enylsulfanyl)propanoate.
| Compound Name | methyl 2-acetamido-3-(4-hydroxybut-2-enylsulfanyl)propanoate |
|---|---|
| PubChem CID | 155886469 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | methyl 2-acetamido-3-(4-hydroxybut-2-enylsulfanyl)propanoate |
| SMILES | COC(=O)C(CSCC=CCO)NC(C)=O |
| InChI | InChI=1S/C10H17NO4S/c1-8(13)11-9(10(14)15-2)7-16-6-4-3-5-12/h3-4,9,12H,5-7H2,1-2H3,(H,11,13) |
| InChIKey | CPBMMSFMHHNWEC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|