C13H9BrClN5O3 — CID 155920143
2-amino-9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloro-7H-purin-8-one (PubChem CID 155920143) has the molecular formula C13H9BrClN5O3 and a molecular weight of 398.60 g/mol. Its IUPAC name is 2-amino-9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloro-7H-purin-8-one.
| Compound Name | 2-amino-9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloro-7H-purin-8-one |
|---|---|
| PubChem CID | 155920143 |
| Molecular Formula | C13H9BrClN5O3 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | 2-amino-9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloro-7H-purin-8-one |
| SMILES | Nc1nc(Cl)c2[nH]c(=O)n(Cc3cc4c(cc3Br)OCO4)c2n1 |
| InChI | InChI=1S/C13H9BrClN5O3/c14-6-2-8-7(22-4-23-8)1-5(6)3-20-11-9(17-13(20)21)10(15)18-12(16)19-11/h1-2H,3-4H2,(H,17,21)(H2,16,18,19) |
| InChIKey | JGUUSDOBVPWHAQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |