C18H27FN2O — CID 155930418
(2S,5S)-1-butyl-N-(2,6-dimethylphenyl)-5-fluoropiperidine-2-carboxamide (PubChem CID 155930418) has the molecular formula C18H27FN2O and a molecular weight of 306.43 g/mol. Its IUPAC name is (2S,5S)-1-butyl-N-(2,6-dimethylphenyl)-5-fluoropiperidine-2-carboxamide.
| Compound Name | (2S,5S)-1-butyl-N-(2,6-dimethylphenyl)-5-fluoropiperidine-2-carboxamide |
|---|---|
| PubChem CID | 155930418 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (2S,5S)-1-butyl-N-(2,6-dimethylphenyl)-5-fluoropiperidine-2-carboxamide |
| SMILES | CCCCN1C[C@@H](F)CC[C@H]1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C18H27FN2O/c1-4-5-11-21-12-15(19)9-10-16(21)18(22)20-17-13(2)7-6-8-14(17)3/h6-8,15-16H,4-5,9-12H2,1-3H3,(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | UWICITDJFZKQFE-HOTGVXAUSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |