C33H48N2O10Si2 — CID 155932143
4-O-ethyl 1-O-methyl (2R)-2-[2-[tert-butyl(diphenyl)silyl]oxy-1-[3-(methoxymethoxy)propanoyloxy]ethyl]-3-diazo-2-trimethylsilyloxybutanedioate (PubChem CID 155932143) has the molecular formula C33H48N2O10Si2 and a molecular weight of 688.92 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl (2R)-2-[2-[tert-butyl(diphenyl)silyl]oxy-1-[3-(methoxymethoxy)propanoyloxy]ethyl]-3-diazo-2-trimethylsilyloxybutanedioate.
| Compound Name | 4-O-ethyl 1-O-methyl (2R)-2-[2-[tert-butyl(diphenyl)silyl]oxy-1-[3-(methoxymethoxy)propanoyloxy]ethyl]-3-diazo-2-trimethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 155932143 |
| Molecular Formula | C33H48N2O10Si2 |
| Molecular Weight | 688.92 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | 4-O-ethyl 1-O-methyl (2R)-2-[2-[tert-butyl(diphenyl)silyl]oxy-1-[3-(methoxymethoxy)propanoyloxy]ethyl]-3-diazo-2-trimethylsilyloxybutanedioate |
| SMILES | CCOC(=O)C(=[N+]=[N-])[C@](O[Si](C)(C)C)(C(=O)OC)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)CCOCOC |
| InChI | InChI=1S/C33H48N2O10Si2/c1-10-42-30(37)29(35-34)33(31(38)40-6,45-46(7,8)9)27(44-28(36)21-22-41-24-39-5)23-43-47(32(2,3)4,25-17-13-11-14-18-25)26-19-15-12-16-20-26/h11-20,27H,10,21-24H2,1-9H3/t27?,33-/m0/s1 |
| InChIKey | JFTYZSCMNNNHBG-UWPPNVRMSA-N |
| XLogP | 3.48 |
| TPSA | 152.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.92 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|