C38H58N2O10Si2 — CID 135451091
ditert-butyl (2S)-2-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[3-(methoxymethoxy)propanoyloxy]ethyl]-3-diazo-2-trimethylsilyloxybutanedioate (PubChem CID 135451091) has the molecular formula C38H58N2O10Si2 and a molecular weight of 759.06 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[3-(methoxymethoxy)propanoyloxy]ethyl]-3-diazo-2-trimethylsilyloxybutanedioate.
| Compound Name | ditert-butyl (2S)-2-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[3-(methoxymethoxy)propanoyloxy]ethyl]-3-diazo-2-trimethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 135451091 |
| Molecular Formula | C38H58N2O10Si2 |
| Molecular Weight | 759.06 g/mol |
| Exact Mass | 758.36 |
| IUPAC Name | ditert-butyl (2S)-2-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-[3-(methoxymethoxy)propanoyloxy]ethyl]-3-diazo-2-trimethylsilyloxybutanedioate |
| SMILES | COCOCCC(=O)O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@](O[Si](C)(C)C)(C(=O)OC(C)(C)C)C(=[N+]=[N-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H58N2O10Si2/c1-35(2,3)48-33(42)32(40-39)38(50-51(11,12)13,34(43)49-36(4,5)6)30(47-31(41)24-25-45-27-44-10)26-46-52(37(7,8)9,28-20-16-14-17-21-28)29-22-18-15-19-23-29/h14-23,30H,24-27H2,1-13H3/t30-,38-/m1/s1 |
| InChIKey | XKBKFSOIXOLKQV-UKZNZPTOSA-N |
| XLogP | 5.43 |
| TPSA | 152.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.06 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|