C10H11IN2O3S — CID 155947697
2-[2-(2-hydroxy-4-iodoanilino)-2-oxoethyl]sulfanylacetamide (PubChem CID 155947697) has the molecular formula C10H11IN2O3S and a molecular weight of 366.18 g/mol. Its IUPAC name is 2-[2-(2-hydroxy-4-iodoanilino)-2-oxoethyl]sulfanylacetamide.
| Compound Name | 2-[2-(2-hydroxy-4-iodoanilino)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 155947697 |
| Molecular Formula | C10H11IN2O3S |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 2-[2-(2-hydroxy-4-iodoanilino)-2-oxoethyl]sulfanylacetamide |
| SMILES | NC(=O)CSCC(=O)Nc1ccc(I)cc1O |
| InChI | InChI=1S/C10H11IN2O3S/c11-6-1-2-7(8(14)3-6)13-10(16)5-17-4-9(12)15/h1-3,14H,4-5H2,(H2,12,15)(H,13,16) |
| InChIKey | MMMQIQIUXJZWCK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|