C20H31FN6O3 — CID 156542798
(2R,3R,4S,5R)-2-(4-amino-5-fluoro-6-methyl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl)-5-(1,8-diazaspiro[4.5]decan-1-ylmethyl)oxolane-3,4-diol (PubChem CID 156542798) has the molecular formula C20H31FN6O3 and a molecular weight of 422.51 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-amino-5-fluoro-6-methyl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl)-5-(1,8-diazaspiro[4.5]decan-1-ylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(4-amino-5-fluoro-6-methyl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl)-5-(1,8-diazaspiro[4.5]decan-1-ylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 156542798 |
| Molecular Formula | C20H31FN6O3 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-amino-5-fluoro-6-methyl-5,6-dihydropyrrolo[2,3-d]pyrimidin-7-yl)-5-(1,8-diazaspiro[4.5]decan-1-ylmethyl)oxolane-3,4-diol |
| SMILES | CC1C(F)c2c(N)ncnc2N1[C@@H]1O[C@H](CN2CCCC23CCNCC3)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H31FN6O3/c1-11-14(21)13-17(22)24-10-25-18(13)27(11)19-16(29)15(28)12(30-19)9-26-8-2-3-20(26)4-6-23-7-5-20/h10-12,14-16,19,23,28-29H,2-9H2,1H3,(H2,22,24,25)/t11?,12-,14?,15-,16-,19-/m1/s1 |
| InChIKey | NXDICSYZOYIMKL-CTKKJMPRSA-N |
| XLogP | -0.06 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |