C25H26ClN5O4 — CID 156571374
6-[2-[(6-chloro-2,3,3a,7a-tetrahydro-1-benzofuran-5-yl)amino]-7-methyl-8-oxopurin-9-yl]tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylic acid (PubChem CID 156571374) has the molecular formula C25H26ClN5O4 and a molecular weight of 495.97 g/mol. Its IUPAC name is 6-[2-[(6-chloro-2,3,3a,7a-tetrahydro-1-benzofuran-5-yl)amino]-7-methyl-8-oxopurin-9-yl]tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylic acid.
| Compound Name | 6-[2-[(6-chloro-2,3,3a,7a-tetrahydro-1-benzofuran-5-yl)amino]-7-methyl-8-oxopurin-9-yl]tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 156571374 |
| Molecular Formula | C25H26ClN5O4 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 6-[2-[(6-chloro-2,3,3a,7a-tetrahydro-1-benzofuran-5-yl)amino]-7-methyl-8-oxopurin-9-yl]tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylic acid |
| SMILES | Cn1c(=O)n(C2C3CC4CC5(C(=O)O)CC2C35C4)c2nc(NC3=CC4CCOC4C=C3Cl)ncc21 |
| InChI | InChI=1S/C25H26ClN5O4/c1-30-17-10-27-22(28-16-5-12-2-3-35-18(12)6-15(16)26)29-20(17)31(23(30)34)19-13-4-11-7-24(21(32)33)9-14(19)25(13,24)8-11/h5-6,10-14,18-19H,2-4,7-9H2,1H3,(H,32,33)(H,27,28,29) |
| InChIKey | RDBMQAGXXVHVIE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |