C46H35N4O2Pt-3 — CID 156627330
CID 156627330 (PubChem CID 156627330) has the molecular formula C46H35N4O2Pt-3 and a molecular weight of 870.89 g/mol.
| Compound Name | CID 156627330 |
|---|---|
| PubChem CID | 156627330 |
| Molecular Formula | C46H35N4O2Pt-3 |
| Molecular Weight | 870.89 g/mol |
| Exact Mass | 870.24 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnn(-c2[c-]c3c(cc2)oc2ccc4oc5ccc(N6[CH-]N(c7ccccc7)c7ccccc76)[c-]c5c4c23)c1.[Pt] |
| InChI | InChI=1S/C46H35N4O2.Pt/c1-28(2)34-13-10-14-35(29(3)4)44(34)30-25-47-50(26-30)33-18-20-41-37(24-33)46-43(52-41)22-21-42-45(46)36-23-32(17-19-40(36)51-42)49-27-48(31-11-6-5-7-12-31)38-15-8-9-16-39(38)49;/h5-22,25-29H,1-4H3;/q-3; |
| InChIKey | PWLRQDWSXHAZEM-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.89 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|