C46H48BN5Pt — CID 166028838
1,2-bis[3-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]benzene-2-id-1-yl]azaborinine;platinum(2+) (PubChem CID 166028838) has the molecular formula C46H48BN5Pt and a molecular weight of 876.81 g/mol. Its IUPAC name is 1,2-bis[3-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]benzene-2-id-1-yl]azaborinine;platinum(2+).
| Compound Name | 1,2-bis[3-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]benzene-2-id-1-yl]azaborinine;platinum(2+) |
|---|---|
| PubChem CID | 166028838 |
| Molecular Formula | C46H48BN5Pt |
| Molecular Weight | 876.81 g/mol |
| Exact Mass | 876.37 |
| IUPAC Name | 1,2-bis[3-[4-[2,6-di(propan-2-yl)phenyl]pyrazol-1-yl]benzene-2-id-1-yl]azaborinine;platinum(2+) |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnn(-c2[c-]c(B3C=CC=CN3c3[c-]c(-n4cc(-c5c(C(C)C)cccc5C(C)C)cn4)ccc3)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C46H48BN5.Pt/c1-31(2)41-19-13-20-42(32(3)4)45(41)35-27-48-51(29-35)39-17-11-15-37(25-39)47-23-9-10-24-50(47)38-16-12-18-40(26-38)52-30-36(28-49-52)46-43(33(5)6)21-14-22-44(46)34(7)8;/h9-24,27-34H,1-8H3;/q-2;+2 |
| InChIKey | ZSVPOPBHTIISNK-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.81 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|