C41H40ClN3O6S — CID 156631390
4-[[2-[1-[2-[4-[(E)-4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]sulfanyl]butanamide (PubChem CID 156631390) has the molecular formula C41H40ClN3O6S and a molecular weight of 738.31 g/mol. Its IUPAC name is 4-[[2-[1-[2-[4-[(E)-4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]sulfanyl]butanamide.
| Compound Name | 4-[[2-[1-[2-[4-[(E)-4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 156631390 |
| Molecular Formula | C41H40ClN3O6S |
| Molecular Weight | 738.31 g/mol |
| Exact Mass | 737.23 |
| IUPAC Name | 4-[[2-[1-[2-[4-[(E)-4-chloro-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]sulfanyl]butanamide |
| SMILES | NC(=O)CCCSc1cccc2c1CN(C1CCC(=O)N(CCOc3ccc(/C(=C(\CCCl)c4ccccc4)c4ccc(O)cc4)cc3)C1=O)C2=O |
| InChI | InChI=1S/C41H40ClN3O6S/c42-22-21-32(27-6-2-1-3-7-27)39(28-11-15-30(46)16-12-28)29-13-17-31(18-14-29)51-24-23-44-38(48)20-19-35(41(44)50)45-26-34-33(40(45)49)8-4-9-36(34)52-25-5-10-37(43)47/h1-4,6-9,11-18,35,46H,5,10,19-26H2,(H2,43,47)/b39-32+ |
| InChIKey | VUVBZZMKEYUZDC-LETMKSKHSA-N |
| XLogP | 6.89 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.31 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|