C17H29NO12 — CID 156656662
[butanoyl-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl] 2-(2-methoxyethoxy)ethyl carbonate (PubChem CID 156656662) has the molecular formula C17H29NO12 and a molecular weight of 439.41 g/mol. Its IUPAC name is [butanoyl-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl] 2-(2-methoxyethoxy)ethyl carbonate.
| Compound Name | [butanoyl-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl] 2-(2-methoxyethoxy)ethyl carbonate |
|---|---|
| PubChem CID | 156656662 |
| Molecular Formula | C17H29NO12 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [butanoyl-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl] 2-(2-methoxyethoxy)ethyl carbonate |
| SMILES | CCCC(=O)N(C(=O)OC(=O)OCCOCCOC)[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H29NO12/c1-3-4-11(20)18(12-14(22)13(21)10(9-19)29-15(12)23)16(24)30-17(25)28-8-7-27-6-5-26-2/h10,12-15,19,21-23H,3-9H2,1-2H3/t10-,12-,13-,14-,15?/m1/s1 |
| InChIKey | OSOUCHKAJVPYJZ-RKHBJWJHSA-N |
| XLogP | -1.65 |
| TPSA | 181.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|