C17H27NO6S — CID 139295266
N-(2-thiophen-2-ylpropan-2-yl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanamide (PubChem CID 139295266) has the molecular formula C17H27NO6S and a molecular weight of 373.47 g/mol. Its IUPAC name is N-(2-thiophen-2-ylpropan-2-yl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanamide.
| Compound Name | N-(2-thiophen-2-ylpropan-2-yl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanamide |
|---|---|
| PubChem CID | 139295266 |
| Molecular Formula | C17H27NO6S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(2-thiophen-2-ylpropan-2-yl)-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanamide |
| SMILES | CCCC(=O)N([C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O)C(C)(C)c1cccs1 |
| InChI | InChI=1S/C17H27NO6S/c1-4-6-12(20)18(17(2,3)11-7-5-8-25-11)13-15(22)14(21)10(9-19)24-16(13)23/h5,7-8,10,13-16,19,21-23H,4,6,9H2,1-3H3/t10-,13-,14-,15-,16?/m1/s1 |
| InChIKey | GRCZRZBARORCRE-ZTNWJSEGSA-N |
| XLogP | 0.41 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |