C15H23NO11 — CID 139295593
4-[butanoyl-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl]oxy-4-oxobutanoic acid (PubChem CID 139295593) has the molecular formula C15H23NO11 and a molecular weight of 393.35 g/mol. Its IUPAC name is 4-[butanoyl-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[butanoyl-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139295593 |
| Molecular Formula | C15H23NO11 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[butanoyl-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl]oxy-4-oxobutanoic acid |
| SMILES | CCCC(=O)N(C(=O)OC(=O)CCC(=O)O)[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H23NO11/c1-2-3-8(18)16(15(25)27-10(21)5-4-9(19)20)11-13(23)12(22)7(6-17)26-14(11)24/h7,11-14,17,22-24H,2-6H2,1H3,(H,19,20)/t7-,11-,12-,13-,14?/m1/s1 |
| InChIKey | JSQVXWSQCVNMFH-LZXMZVSGSA-N |
| XLogP | -2.06 |
| TPSA | 191.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|