C25H36Cl2N2O4S — CID 156723177
3-azabicyclo[3.1.0]hexan-3-yl-(2,2-dimethyl-1,3-dioxolan-4-yl)methanone;N-tert-butylsulfanyl-1-(4,5-dichloro-2-prop-2-enoxyphenyl)methanamine (PubChem CID 156723177) has the molecular formula C25H36Cl2N2O4S and a molecular weight of 531.55 g/mol. Its IUPAC name is 3-azabicyclo[3.1.0]hexan-3-yl-(2,2-dimethyl-1,3-dioxolan-4-yl)methanone;N-tert-butylsulfanyl-1-(4,5-dichloro-2-prop-2-enoxyphenyl)methanamine.
| Compound Name | 3-azabicyclo[3.1.0]hexan-3-yl-(2,2-dimethyl-1,3-dioxolan-4-yl)methanone;N-tert-butylsulfanyl-1-(4,5-dichloro-2-prop-2-enoxyphenyl)methanamine |
|---|---|
| PubChem CID | 156723177 |
| Molecular Formula | C25H36Cl2N2O4S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 3-azabicyclo[3.1.0]hexan-3-yl-(2,2-dimethyl-1,3-dioxolan-4-yl)methanone;N-tert-butylsulfanyl-1-(4,5-dichloro-2-prop-2-enoxyphenyl)methanamine |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1CNSC(C)(C)C.CC1(C)OCC(C(=O)N2CC3CC3C2)O1 |
| InChI | InChI=1S/C14H19Cl2NOS.C11H17NO3/c1-5-6-18-13-8-12(16)11(15)7-10(13)9-17-19-14(2,3)4;1-11(2)14-6-9(15-11)10(13)12-4-7-3-8(7)5-12/h5,7-8,17H,1,6,9H2,2-4H3;7-9H,3-6H2,1-2H3 |
| InChIKey | ZLBCBCCDRQREDG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|