C26H25Cl2N7O3 — CID 156730481
4-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-(4-morpholin-4-ylphenyl)-1,3,5-triazin-2-amine (PubChem CID 156730481) has the molecular formula C26H25Cl2N7O3 and a molecular weight of 554.44 g/mol. Its IUPAC name is 4-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-(4-morpholin-4-ylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-(4-morpholin-4-ylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 156730481 |
| Molecular Formula | C26H25Cl2N7O3 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 4-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-(4-morpholin-4-ylphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(OC)c(Cl)c(Nc2ncccc2-c2ncnc(Nc3ccc(N4CCOCC4)cc3)n2)c1Cl |
| InChI | InChI=1S/C26H25Cl2N7O3/c1-36-19-14-20(37-2)22(28)23(21(19)27)33-24-18(4-3-9-29-24)25-30-15-31-26(34-25)32-16-5-7-17(8-6-16)35-10-12-38-13-11-35/h3-9,14-15H,10-13H2,1-2H3,(H,29,33)(H,30,31,32,34) |
| InChIKey | UKBBVTHWEXMNFM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|