C15H16F2N6O2 — CID 156742416
1-[(2,6-difluoro-4-nitrophenyl)methyl]-4-methylpyrazolo[3,4-d]pyrimidin-6-amine;ethane (PubChem CID 156742416) has the molecular formula C15H16F2N6O2 and a molecular weight of 350.33 g/mol. Its IUPAC name is 1-[(2,6-difluoro-4-nitrophenyl)methyl]-4-methylpyrazolo[3,4-d]pyrimidin-6-amine;ethane.
| Compound Name | 1-[(2,6-difluoro-4-nitrophenyl)methyl]-4-methylpyrazolo[3,4-d]pyrimidin-6-amine;ethane |
|---|---|
| PubChem CID | 156742416 |
| Molecular Formula | C15H16F2N6O2 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[(2,6-difluoro-4-nitrophenyl)methyl]-4-methylpyrazolo[3,4-d]pyrimidin-6-amine;ethane |
| SMILES | CC.Cc1nc(N)nc2c1cnn2Cc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H10F2N6O2.C2H6/c1-6-8-4-17-20(12(8)19-13(16)18-6)5-9-10(14)2-7(21(22)23)3-11(9)15;1-2/h2-4H,5H2,1H3,(H2,16,18,19);1-2H3 |
| InChIKey | JQNZBBHQUYJWKQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|