About N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide
N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide (PubChem CID 156747461) has the molecular formula C12H17N5O3
and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide |
| PubChem CID | 156747461 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide |
| SMILES | CCCCn1c(=O)n(C)c2nc(NC(C)=O)[nH]c(=O)c21 |
| InChI | InChI=1S/C12H17N5O3/c1-4-5-6-17-8-9(16(3)12(17)20)14-11(13-7(2)18)15-10(8)19/h4-6H2,1-3H3,(H2,13,14,15,18,19) |
| InChIKey | LFQQXIKNEBZVGC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide?
The IUPAC name of N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide (CID 156747461) is N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide.
What is the SMILES notation for N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide?
The canonical SMILES for N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide is CCCCn1c(=O)n(C)c2nc(NC(C)=O)[nH]c(=O)c21.
What is the InChIKey of N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide?
The InChIKey is LFQQXIKNEBZVGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O3/c1-4-5-6-17-8-9(16(3)12(17)20)14-11(13-7(2)18)15-10(8)19/h4-6H2,1-3H3,(H2,13,14,15,18,19).
What are the key properties of N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide?
N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide has a molecular weight of 279.30 g/mol, XLogP of 0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-butyl-9-methyl-6,8-dioxo-1H-purin-2-yl)acetamide is sourced from PubChem (CID 156747461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).